Antilles

Antilles

2004/09 Antilles Exercice II. Hydrolyse basique des esters (6,5 points) Corrige 1. Cinetique de la saponification du methanoate d’ethyle 1. 1. 1. NaOH(s) = Na+(aq) + HO–(aq) transformation totale D’apres l’equation precedente on a [HO–(aq)] = [Na+(aq)] = C0 = 1,00. 10–2 mol. L-1 (1dm3 = 1L) 1. 1. 2. G0 = k? ( [pic]? [Na+(aq)] + [pic]? [HO–(aq)]) = k? C0? ( [pic] + [pic] ) G0 = [pic]n0 ( [pic] + [pic] ) (1) 1. 1. 3. G0 = k? C0? ( [pic] + [pic] ) Il faut convertir C0 en mol. m–3, donc multiplier C0 par 10 3 G0 = 0,01? 1,00. 10–2 (103 ((5,01. 10–3 + 19,9. 10–3) G0 = 0,01? 1,00. 0–2 ((5,01+19,9) = 2,49 mS On conserve 3 chiffres significatifs (C. S. ), bien que k soit donnee avec 1 seul C. S. , les valeurs de G du tableau 1 comportant 3 C. S. |1. 2. equation chimique |H–CO2–CH2–CH3 + HO– = HCO2– + CH3–CH2–OH | |Etat du systeme |Avancement (mol) |Quantites de matiere (mol) | |Etat initial |0 |n0 |n0 |0 |0 |Etat intermediaire |x |n0 – x |n0 – x |x |x | 1. 3. 1. Gt = k ? ( [pic]? [Na+(aq)] + [pic]?

Désolé, mais les essais complets ne sont disponibles que pour les utilisateurs enregistrés

Choisissez un plan d'adhésion
[HO–(aq)] + [pic]? [HCO2-(aq)] ) Gt = k ? ( [pic]? [pic]+ [pic]? [pic]+ [pic]? [pic]) Gt= [pic]? ( [pic]? n0 + [pic]? (n0 – x) + [pic]( x) (2) 1. 3. 2. On developpe l’expression (2): Gt = [pic]? [pic]? n0 + [pic]? [pic]? n0 – [pic]? [pic]( x + [pic] [pic]( x = [pic]. x ([pic] – [pic]) +[pic]? n0 ( [pic] + [pic]) Gt = ax + b (3) avec a = [pic]? ([pic] – [pic]) et b = [pic]? 0 ( [pic] + [pic]) 1. 3. 3. L’expression b correspond a G0, calculee a la question 1. 1. 2. [pic] > [pic]donc la constante a est negative. 1. 3. 4. La representation de Gt en fonction de x serait une droite decroissante. 1. 4. 1. voir graphe page suivante. 1. 4. 2. Vitesse volumique de reaction: v = [pic] ou V est le volume reactionnel suppose constant, et x est l’avancement chimique. Le terme [pic] est egal au coefficient directeur de la tangente a la courbe representative de la fonction x = f(t) a la date t. Pour determiner la vitesse a un instant t, il suffit de calculer le coefficient irecteur de la tangente a la courbe x =f(t) a cette date. 1. 4. 3. On constate que le coefficient directeur [pic] diminue au cours du temps, donc v diminue. 1. 4. 4. Le temps de demi-reaction correspond a l’abscisse du point d’ordonnee [pic]= [pic] Graphiquement on considere le point d’ordonnee 1,00 mmol, soit t1/2 = 12 min 2. Quelques reactions de saponification 1. hexadecanol : C15H31CH2OH Fonction alcool Acide lactique : CH3-CH(OH)-CO2H Fonction alcool Fonction acide carboxylique Palmitate d’hexadecyle : CH3-(CH2)14-COO-(CH2)15-CH3 Fonction ester 2. 2. 1.

CH3-(CH2)14-COO-(CH2)15-CH3(l) + Na+(aq) + HO–(aq) = CH3-(CH2)14-COONa(s) . + C15H31CH2OH(l) 2. 2. 2. Le terme hydrophyle signifie « qui aime l’eau », c’est donc un groupement soluble dans l’eau. Il correspond au groupe carboxylate –COO– Le terme hydrophobe signifie « qui n’aime pas l’eau », c’est donc un groupement insoluble dans l’eau. Il correspond a la longue chaine carbonee CH3-(CH2)14- ———————– 1. 4. 1. Avancement x de la reaction de saponification du methanoate d’ethyle en fonction du temps. x (mmol) t (min) 0 15 30 45 2,0 1,0 0 t1/2 [pic]